C21H14NOS2+ — CID 170655147
7,10-dimethyl-15-oxa-2,19-dithia-10-azoniahexacyclo[11.9.1.03,8.09,23.014,21.016,20]tricosa-1(23),3,5,7,9,11,13,16(20),17,21-decaene (PubChem CID 170655147) has the molecular formula C21H14NOS2+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 7,10-dimethyl-15-oxa-2,19-dithia-10-azoniahexacyclo[11.9.1.03,8.09,23.014,21.016,20]tricosa-1(23),3,5,7,9,11,13,16(20),17,21-decaene.
| Compound Name | 7,10-dimethyl-15-oxa-2,19-dithia-10-azoniahexacyclo[11.9.1.03,8.09,23.014,21.016,20]tricosa-1(23),3,5,7,9,11,13,16(20),17,21-decaene |
|---|---|
| PubChem CID | 170655147 |
| Molecular Formula | C21H14NOS2+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 7,10-dimethyl-15-oxa-2,19-dithia-10-azoniahexacyclo[11.9.1.03,8.09,23.014,21.016,20]tricosa-1(23),3,5,7,9,11,13,16(20),17,21-decaene |
| SMILES | Cc1cccc2c1-c1c3c(cc4c(oc5ccsc54)c3cc[n+]1C)S2 |
| InChI | InChI=1S/C21H14NOS2/c1-11-4-3-5-15-17(11)19-18-12(6-8-22(19)2)20-13(10-16(18)25-15)21-14(23-20)7-9-24-21/h3-10H,1-2H3/q+1 |
| InChIKey | ONUSQAYSBVCOAV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|