C20H23F2N7O2 — CID 170657432
3-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol (PubChem CID 170657432) has the molecular formula C20H23F2N7O2 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 170657432 |
| Molecular Formula | C20H23F2N7O2 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[[5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclobutan-1-ol |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(NC4CC(C)(O)C4)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C20H23F2N7O2/c1-20(30)8-12(9-20)25-19-26-18(31-2)17-13(5-6-29(17)28-19)11-3-4-14(27-23)15(7-11)24-10-16(21)22/h3-7,12,16,23-24,30H,8-10H2,1-2H3,(H,25,28)/b27-23+ |
| InChIKey | FMOYHVAFZZKAKB-SLEBQGDGSA-N |
| XLogP | 4.07 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|