C25H44O7SSi — CID 170667578
methyl (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentyloxy-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonate (PubChem CID 170667578) has the molecular formula C25H44O7SSi and a molecular weight of 516.77 g/mol. Its IUPAC name is methyl (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentyloxy-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonate.
| Compound Name | methyl (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentyloxy-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonate |
|---|---|
| PubChem CID | 170667578 |
| Molecular Formula | C25H44O7SSi |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | methyl (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentyloxy-4-(3,5-dimethoxy-4-methylphenyl)butane-1-sulfonate |
| SMILES | COc1cc([C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCS(=O)(=O)OC)OC2CCCC2)cc(OC)c1C |
| InChI | InChI=1S/C25H44O7SSi/c1-18-22(28-5)16-19(17-23(18)29-6)24(32-34(8,9)25(2,3)4)21(14-15-33(26,27)30-7)31-20-12-10-11-13-20/h16-17,20-21,24H,10-15H2,1-9H3/t21-,24+/m0/s1 |
| InChIKey | WOJAQQPRSHRBBC-XUZZJYLKSA-N |
| XLogP | 5.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|