C24H20FN2S+ — CID 170684641
9-fluoro-11,14-dimethyl-19-propan-2-yl-18-thia-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8,10,12(21),13,15,17(22),19-decaene (PubChem CID 170684641) has the molecular formula C24H20FN2S+ and a molecular weight of 387.50 g/mol. Its IUPAC name is 9-fluoro-11,14-dimethyl-19-propan-2-yl-18-thia-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8,10,12(21),13,15,17(22),19-decaene.
| Compound Name | 9-fluoro-11,14-dimethyl-19-propan-2-yl-18-thia-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8,10,12(21),13,15,17(22),19-decaene |
|---|---|
| PubChem CID | 170684641 |
| Molecular Formula | C24H20FN2S+ |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 9-fluoro-11,14-dimethyl-19-propan-2-yl-18-thia-1-aza-14-azoniahexacyclo[10.8.1.113,17.02,7.08,21.020,22]docosa-2,4,6,8,10,12(21),13,15,17(22),19-decaene |
| SMILES | Cc1cc(F)c2c3ccccc3n3c4c(C(C)C)sc5cc[n+](C)c(c1c23)c54 |
| InChI | InChI=1S/C24H20FN2S/c1-12(2)24-23-20-17(28-24)9-10-26(4)21(20)18-13(3)11-15(25)19-14-7-5-6-8-16(14)27(23)22(18)19/h5-12H,1-4H3/q+1 |
| InChIKey | BKJURRFEPQXFNT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|