C16H18N4O2 — CID 170685616
(4R,7R)-4,12-dimethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione (PubChem CID 170685616) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (4R,7R)-4,12-dimethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione.
| Compound Name | (4R,7R)-4,12-dimethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione |
|---|---|
| PubChem CID | 170685616 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (4R,7R)-4,12-dimethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraene-8,11-dione |
| SMILES | C[C@@H]1CN2c3c(c(=O)n(C)c4ccccc34)NC(=O)[C@H]2CN1 |
| InChI | InChI=1S/C16H18N4O2/c1-9-8-20-12(7-17-9)15(21)18-13-14(20)10-5-3-4-6-11(10)19(2)16(13)22/h3-6,9,12,17H,7-8H2,1-2H3,(H,18,21)/t9-,12-/m1/s1 |
| InChIKey | CAQKPWALTOSAKL-BXKDBHETSA-N |
| XLogP | 0.66 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |