C66H68N8Pt2-4 — CID 170690860
[3-[5-(5-methyl-4-phenylpyrazol-1-id-3-yl)pentyl]-1-phenyl-4-(2,4,6-trimethylphenyl)imidazol-2-ylidene]platinum (PubChem CID 170690860) has the molecular formula C66H68N8Pt2-4 and a molecular weight of 1363.48 g/mol. Its IUPAC name is [3-[5-(5-methyl-4-phenylpyrazol-1-id-3-yl)pentyl]-1-phenyl-4-(2,4,6-trimethylphenyl)imidazol-2-ylidene]platinum.
| Compound Name | [3-[5-(5-methyl-4-phenylpyrazol-1-id-3-yl)pentyl]-1-phenyl-4-(2,4,6-trimethylphenyl)imidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 170690860 |
| Molecular Formula | C66H68N8Pt2-4 |
| Molecular Weight | 1363.48 g/mol |
| Exact Mass | 1362.49 |
| IUPAC Name | [3-[5-(5-methyl-4-phenylpyrazol-1-id-3-yl)pentyl]-1-phenyl-4-(2,4,6-trimethylphenyl)imidazol-2-ylidene]platinum |
| SMILES | Cc1cc(C)c(-c2cn(-c3[c-]cccc3)c(=[Pt])n2CCCCCc2n[n-]c(C)c2-c2ccccc2)c(C)c1.Cc1cc(C)c(-c2cn(-c3[c-]cccc3)c(=[Pt])n2CCCCCc2n[n-]c(C)c2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/2C33H34N4.2Pt/c2*1-24-20-25(2)32(26(3)21-24)31-22-37(29-16-10-6-11-17-29)23-36(31)19-13-7-12-18-30-33(27(4)34-35-30)28-14-8-5-9-15-28;;/h2*5-6,8-11,14-16,20-22H,7,12-13,18-19H2,1-4H3;;/q2*-2;; |
| InChIKey | KGQQFMPPKNEMFP-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 73.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1363.48 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|