C10H17NO — CID 170691455
6-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 170691455) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 6-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 6-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 170691455 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 6-amino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CC(=O)C1(C)C(N)C2 |
| InChI | InChI=1S/C10H17NO/c1-9(2)6-4-7(11)10(9,3)8(12)5-6/h6-7H,4-5,11H2,1-3H3 |
| InChIKey | LNPBJUVGQLRVTH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |