C20H40F4N2 — CID 170692692
2,2,3,3-tetrafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)butane-1,4-diamine (PubChem CID 170692692) has the molecular formula C20H40F4N2 and a molecular weight of 384.55 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)butane-1,4-diamine.
| Compound Name | 2,2,3,3-tetrafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 170692692 |
| Molecular Formula | C20H40F4N2 |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)butane-1,4-diamine |
| SMILES | CC(C)(C)CC(C)(C)NCC(F)(F)C(F)(F)CNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H40F4N2/c1-15(2,3)11-17(7,8)25-13-19(21,22)20(23,24)14-26-18(9,10)12-16(4,5)6/h25-26H,11-14H2,1-10H3 |
| InChIKey | YEVAQWYUQBWNQE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|