C22H40F8N2 — CID 170692693
2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)hexane-1,6-diamine (PubChem CID 170692693) has the molecular formula C22H40F8N2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)hexane-1,6-diamine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 170692693 |
| Molecular Formula | C22H40F8N2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2,4,4-trimethylpentan-2-yl)hexane-1,6-diamine |
| SMILES | CC(C)(C)CC(C)(C)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C22H40F8N2/c1-15(2,3)11-17(7,8)31-13-19(23,24)21(27,28)22(29,30)20(25,26)14-32-18(9,10)12-16(4,5)6/h31-32H,11-14H2,1-10H3 |
| InChIKey | OMLDUACKWYVHSW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|