C5H5N2O2S3- — CID 170703338
5-(2-carboxyethylsulfanyl)-1,3,4-thiadiazole-2-thiolate (PubChem CID 170703338) has the molecular formula C5H5N2O2S3- and a molecular weight of 221.31 g/mol. Its IUPAC name is 5-(2-carboxyethylsulfanyl)-1,3,4-thiadiazole-2-thiolate.
| Compound Name | 5-(2-carboxyethylsulfanyl)-1,3,4-thiadiazole-2-thiolate |
|---|---|
| PubChem CID | 170703338 |
| Molecular Formula | C5H5N2O2S3- |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 220.95 |
| IUPAC Name | 5-(2-carboxyethylsulfanyl)-1,3,4-thiadiazole-2-thiolate |
| SMILES | O=C(O)CCSc1nnc([S-])s1 |
| InChI | InChI=1S/C5H6N2O2S3/c8-3(9)1-2-11-5-7-6-4(10)12-5/h1-2H2,(H,6,10)(H,8,9)/p-1 |
| InChIKey | GJIWVACHHXLDQV-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|