C11H21KN2O3S3Si — CID 102342833
potassium 5-(3-triethoxysilylpropylsulfanyl)-1,3,4-thiadiazole-2-thiolate (PubChem CID 102342833) has the molecular formula C11H21KN2O3S3Si and a molecular weight of 392.69 g/mol. Its IUPAC name is potassium 5-(3-triethoxysilylpropylsulfanyl)-1,3,4-thiadiazole-2-thiolate.
| Compound Name | potassium 5-(3-triethoxysilylpropylsulfanyl)-1,3,4-thiadiazole-2-thiolate |
|---|---|
| PubChem CID | 102342833 |
| Molecular Formula | C11H21KN2O3S3Si |
| Molecular Weight | 392.69 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | potassium 5-(3-triethoxysilylpropylsulfanyl)-1,3,4-thiadiazole-2-thiolate |
| SMILES | CCO[Si](CCCSc1nnc([S-])s1)(OCC)OCC.[K+] |
| InChI | InChI=1S/C11H22N2O3S3Si.K/c1-4-14-20(15-5-2,16-6-3)9-7-8-18-11-13-12-10(17)19-11;/h4-9H2,1-3H3,(H,12,17);/q;+1/p-1 |
| InChIKey | OMOBFMJZFOIINQ-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.69 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|