C17H20N4O2S — CID 170703935
3-[4-[[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanylmethyl]triazol-1-yl]-N-hydroxybenzamide (PubChem CID 170703935) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-[4-[[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanylmethyl]triazol-1-yl]-N-hydroxybenzamide.
| Compound Name | 3-[4-[[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanylmethyl]triazol-1-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 170703935 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[4-[[(2Z,4E)-hepta-2,4-dien-4-yl]sulfanylmethyl]triazol-1-yl]-N-hydroxybenzamide |
| SMILES | C/C=C\C(=C/CC)SCc1cn(-c2cccc(C(=O)NO)c2)nn1 |
| InChI | InChI=1S/C17H20N4O2S/c1-3-6-16(7-4-2)24-12-14-11-21(20-18-14)15-9-5-8-13(10-15)17(22)19-23/h3,5-11,23H,4,12H2,1-2H3,(H,19,22)/b6-3-,16-7+ |
| InChIKey | TWCVOLBZBMNBTJ-BYTXJHPBSA-N |
| XLogP | 3.49 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|