C18H14N4O2S — CID 171354600
3-[4-(1H-indol-3-ylsulfanylmethyl)triazol-1-yl]benzoic acid (PubChem CID 171354600) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 3-[4-(1H-indol-3-ylsulfanylmethyl)triazol-1-yl]benzoic acid.
| Compound Name | 3-[4-(1H-indol-3-ylsulfanylmethyl)triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 171354600 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-[4-(1H-indol-3-ylsulfanylmethyl)triazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2cc(CSc3c[nH]c4ccccc34)nn2)c1 |
| InChI | InChI=1S/C18H14N4O2S/c23-18(24)12-4-3-5-14(8-12)22-10-13(20-21-22)11-25-17-9-19-16-7-2-1-6-15(16)17/h1-10,19H,11H2,(H,23,24) |
| InChIKey | WLTLQBZMUNBKII-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |