C12H18F3N — CID 170710133
3-methyl-N-[(Z)-4,4,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine (PubChem CID 170710133) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-4,4,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine.
| Compound Name | 3-methyl-N-[(Z)-4,4,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine |
|---|---|
| PubChem CID | 170710133 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-methyl-N-[(Z)-4,4,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine |
| SMILES | C=C(/C=C\N=C(/C)C(C)CC)C(F)(F)CF |
| InChI | InChI=1S/C12H18F3N/c1-5-9(2)11(4)16-7-6-10(3)12(14,15)8-13/h6-7,9H,3,5,8H2,1-2,4H3/b7-6-,16-11+ |
| InChIKey | XJCKRQCLSJLCRA-HWEBNEHYSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|