C9H16O3S2 — CID 170710722
[(4R,5R)-5-hydroxydithian-4-yl] 2,2-dimethylpropanoate (PubChem CID 170710722) has the molecular formula C9H16O3S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is [(4R,5R)-5-hydroxydithian-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(4R,5R)-5-hydroxydithian-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170710722 |
| Molecular Formula | C9H16O3S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | [(4R,5R)-5-hydroxydithian-4-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1CSSC[C@@H]1O |
| InChI | InChI=1S/C9H16O3S2/c1-9(2,3)8(11)12-7-5-14-13-4-6(7)10/h6-7,10H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | JMLLWCFPZMFQTH-BQBZGAKWSA-N |
| XLogP | 1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|