C17H27BN2O3 — CID 170711858
4-[6,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyran-2-yl]-1-methylpyrazole (PubChem CID 170711858) has the molecular formula C17H27BN2O3 and a molecular weight of 318.23 g/mol. Its IUPAC name is 4-[6,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyran-2-yl]-1-methylpyrazole.
| Compound Name | 4-[6,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyran-2-yl]-1-methylpyrazole |
|---|---|
| PubChem CID | 170711858 |
| Molecular Formula | C17H27BN2O3 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-[6,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyran-2-yl]-1-methylpyrazole |
| SMILES | Cn1cc(C2CC(B3OC(C)(C)C(C)(C)O3)=CC(C)(C)O2)cn1 |
| InChI | InChI=1S/C17H27BN2O3/c1-15(2)9-13(18-22-16(3,4)17(5,6)23-18)8-14(21-15)12-10-19-20(7)11-12/h9-11,14H,8H2,1-7H3 |
| InChIKey | VALNXFYYOWAWRS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|