C17H14BFIO3PS2 — CID 170715006
(6-iodosulfanyl-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(16),9,11,13(17),14-pentaen-7-yn-15-yl)oxy thiohypofluorite (PubChem CID 170715006) has the molecular formula C17H14BFIO3PS2 and a molecular weight of 518.12 g/mol. Its IUPAC name is (6-iodosulfanyl-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(16),9,11,13(17),14-pentaen-7-yn-15-yl)oxy thiohypofluorite.
| Compound Name | (6-iodosulfanyl-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(16),9,11,13(17),14-pentaen-7-yn-15-yl)oxy thiohypofluorite |
|---|---|
| PubChem CID | 170715006 |
| Molecular Formula | C17H14BFIO3PS2 |
| Molecular Weight | 518.12 g/mol |
| Exact Mass | 517.92 |
| IUPAC Name | (6-iodosulfanyl-4,4,5-trimethyl-3,18-dioxa-6-phospha-2-boratetracyclo[7.7.1.12,5.013,17]octadeca-1(16),9,11,13(17),14-pentaen-7-yn-15-yl)oxy thiohypofluorite |
| SMILES | CC1(C)OB2OC1(C)P(SI)C#Cc1cccc3cc(OSF)cc2c13 |
| InChI | InChI=1S/C17H14BFIO3PS2/c1-16(2)17(3)23-18(22-16)14-10-13(21-25-19)9-12-6-4-5-11(15(12)14)7-8-24(17)26-20/h4-6,9-10H,1-3H3 |
| InChIKey | RPMMIBFTLZRMBI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.12 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|