About 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine
5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine (PubChem CID 170719137) has the molecular formula C18H28F3NO2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine.
Molecular Properties
| Compound Name | 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine |
| PubChem CID | 170719137 |
| Molecular Formula | C18H28F3NO2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine |
| SMILES | NCCCCCOCCCCCOCCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C18H28F3NO2/c19-15-13-17(20)16(18(21)14-15)7-12-24-11-6-2-5-10-23-9-4-1-3-8-22/h13-14H,1-12,22H2 |
| InChIKey | JWPGFNKGEJKQPQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine?
The IUPAC name of 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine (CID 170719137) is 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine.
What is the SMILES notation for 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine?
The canonical SMILES for 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine is NCCCCCOCCCCCOCCc1c(F)cc(F)cc1F.
What is the InChIKey of 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine?
The InChIKey is JWPGFNKGEJKQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28F3NO2/c19-15-13-17(20)16(18(21)14-15)7-12-24-11-6-2-5-10-23-9-4-1-3-8-22/h13-14H,1-12,22H2.
What are the key properties of 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine?
5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine has a molecular weight of 347.42 g/mol, XLogP of 3.98, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[2-(2,4,6-trifluorophenyl)ethoxy]pentoxy]pentan-1-amine is sourced from PubChem (CID 170719137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).