C29H33FN8S — CID 170725956
N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-2-[3-(4-fluoropiperidin-1-yl)phenyl]-[1,3]thiazolo[5,4-c]pyridin-6-amine (PubChem CID 170725956) has the molecular formula C29H33FN8S and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-2-[3-(4-fluoropiperidin-1-yl)phenyl]-[1,3]thiazolo[5,4-c]pyridin-6-amine.
| Compound Name | N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-2-[3-(4-fluoropiperidin-1-yl)phenyl]-[1,3]thiazolo[5,4-c]pyridin-6-amine |
|---|---|
| PubChem CID | 170725956 |
| Molecular Formula | C29H33FN8S |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | N-[2-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-6-methylpyrimidin-4-yl]-2-[3-(4-fluoropiperidin-1-yl)phenyl]-[1,3]thiazolo[5,4-c]pyridin-6-amine |
| SMILES | CCN1C[C@@H]2C[C@H]1CN2c1nc(C)cc(Nc2cc3nc(-c4cccc(N5CCC(F)CC5)c4)sc3cn2)n1 |
| InChI | InChI=1S/C29H33FN8S/c1-3-36-16-23-13-22(36)17-38(23)29-32-18(2)11-27(35-29)34-26-14-24-25(15-31-26)39-28(33-24)19-5-4-6-21(12-19)37-9-7-20(30)8-10-37/h4-6,11-12,14-15,20,22-23H,3,7-10,13,16-17H2,1-2H3,(H,31,32,34,35)/t22-,23-/m0/s1 |
| InChIKey | SRKLTGLDKRHOKP-GOTSBHOMSA-N |
| XLogP | 5.42 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |