C18H18N4O4 — CID 170727084
(3S)-3-(13-oxo-9-oxa-2,5,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),7,11,16-tetraen-14-yl)piperidine-2,6-dione (PubChem CID 170727084) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is (3S)-3-(13-oxo-9-oxa-2,5,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),7,11,16-tetraen-14-yl)piperidine-2,6-dione.
| Compound Name | (3S)-3-(13-oxo-9-oxa-2,5,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),7,11,16-tetraen-14-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170727084 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (3S)-3-(13-oxo-9-oxa-2,5,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),7,11,16-tetraen-14-yl)piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc4c(cc3C2=O)OC=C2CNCCN24)C(=O)N1 |
| InChI | InChI=1S/C18H18N4O4/c23-16-2-1-13(17(24)20-16)22-8-10-5-14-15(6-12(10)18(22)25)26-9-11-7-19-3-4-21(11)14/h5-6,9,13,19H,1-4,7-8H2,(H,20,23,24)/t13-/m0/s1 |
| InChIKey | QKHCREYLVITYRW-ZDUSSCGKSA-N |
| XLogP | 0.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|