C9H17N3 — CID 170731703
ethane;6-ethyl-3,5-dimethyl-1,2,4-triazine (PubChem CID 170731703) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is ethane;6-ethyl-3,5-dimethyl-1,2,4-triazine.
| Compound Name | ethane;6-ethyl-3,5-dimethyl-1,2,4-triazine |
|---|---|
| PubChem CID | 170731703 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | ethane;6-ethyl-3,5-dimethyl-1,2,4-triazine |
| SMILES | CC.CCc1nnc(C)nc1C |
| InChI | InChI=1S/C7H11N3.C2H6/c1-4-7-5(2)8-6(3)9-10-7;1-2/h4H2,1-3H3;1-2H3 |
| InChIKey | FJVVLRKMJUKDSF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |