About 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine
3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine (PubChem CID 82414076) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine.
Analyze 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine?
The IUPAC name of 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine (CID 82414076) is 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine.
What is the SMILES notation for 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine?
The canonical SMILES for 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine is Cc1nnc(CCCN)c(C)n1.
What is the InChIKey of 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine?
The InChIKey is GGFSQVBQBVOZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-6-8(4-3-5-9)12-11-7(2)10-6/h3-5,9H2,1-2H3.
What are the key properties of 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine?
3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine has a molecular weight of 166.23 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1,2,4-triazin-6-yl)propan-1-amine is sourced from PubChem (CID 82414076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).