C6H9FN4 — CID 122196525
3-(3-fluoropropyl)-6-methyl-1,2,4,5-tetrazine (PubChem CID 122196525) has the molecular formula C6H9FN4 and a molecular weight of 156.16 g/mol. Its IUPAC name is 3-(3-fluoropropyl)-6-methyl-1,2,4,5-tetrazine.
| Compound Name | 3-(3-fluoropropyl)-6-methyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 122196525 |
| Molecular Formula | C6H9FN4 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3-(3-fluoropropyl)-6-methyl-1,2,4,5-tetrazine |
| SMILES | Cc1nnc(CCCF)nn1 |
| InChI | InChI=1S/C6H9FN4/c1-5-8-10-6(11-9-5)3-2-4-7/h2-4H2,1H3 |
| InChIKey | NHBHZXUDOLZBOY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |