About 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine
3-methyl-6-propan-2-yl-1,2,4,5-tetrazine (PubChem CID 58126553) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine |
| PubChem CID | 58126553 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine |
| SMILES | Cc1nnc(C(C)C)nn1 |
| InChI | InChI=1S/C6H10N4/c1-4(2)6-9-7-5(3)8-10-6/h4H,1-3H3 |
| InChIKey | LEWLJUJLDRGYQR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine?
The IUPAC name of 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine (CID 58126553) is 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine.
What is the SMILES notation for 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine?
The canonical SMILES for 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine is Cc1nnc(C(C)C)nn1.
What is the InChIKey of 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine?
The InChIKey is LEWLJUJLDRGYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-4(2)6-9-7-5(3)8-10-6/h4H,1-3H3.
What are the key properties of 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine?
3-methyl-6-propan-2-yl-1,2,4,5-tetrazine has a molecular weight of 138.17 g/mol, XLogP of 0.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-propan-2-yl-1,2,4,5-tetrazine is sourced from PubChem (CID 58126553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).