C15H22Cl5N7 — CID 162120381
butan-1-amine;3,6-dichloro-5-pentyl-1,2,4-triazine;3,5,6-trichloro-1,2,4-triazine (PubChem CID 162120381) has the molecular formula C15H22Cl5N7 and a molecular weight of 477.66 g/mol. Its IUPAC name is butan-1-amine;3,6-dichloro-5-pentyl-1,2,4-triazine;3,5,6-trichloro-1,2,4-triazine.
| Compound Name | butan-1-amine;3,6-dichloro-5-pentyl-1,2,4-triazine;3,5,6-trichloro-1,2,4-triazine |
|---|---|
| PubChem CID | 162120381 |
| Molecular Formula | C15H22Cl5N7 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | butan-1-amine;3,6-dichloro-5-pentyl-1,2,4-triazine;3,5,6-trichloro-1,2,4-triazine |
| SMILES | CCCCCc1nc(Cl)nnc1Cl.CCCCN.Clc1nnc(Cl)c(Cl)n1 |
| InChI | InChI=1S/C8H11Cl2N3.C4H11N.C3Cl3N3/c1-2-3-4-5-6-7(9)12-13-8(10)11-6;1-2-3-4-5;4-1-2(5)8-9-3(6)7-1/h2-5H2,1H3;2-5H2,1H3; |
| InChIKey | ZHIFYWLSVGKOFS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|