C10H18N4 — CID 117212541
N'-(2,4,6-trimethylpyrimidin-5-yl)propane-1,3-diamine (PubChem CID 117212541) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-(2,4,6-trimethylpyrimidin-5-yl)propane-1,3-diamine.
| Compound Name | N'-(2,4,6-trimethylpyrimidin-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 117212541 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-(2,4,6-trimethylpyrimidin-5-yl)propane-1,3-diamine |
| SMILES | Cc1nc(C)c(NCCCN)c(C)n1 |
| InChI | InChI=1S/C10H18N4/c1-7-10(12-6-4-5-11)8(2)14-9(3)13-7/h12H,4-6,11H2,1-3H3 |
| InChIKey | YPODWAGAZKDINZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|