C9H16N4S — CID 117212570
5-(3-aminopropylamino)-4,6-dimethyl-1H-pyrimidine-2-thione (PubChem CID 117212570) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 5-(3-aminopropylamino)-4,6-dimethyl-1H-pyrimidine-2-thione.
| Compound Name | 5-(3-aminopropylamino)-4,6-dimethyl-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 117212570 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5-(3-aminopropylamino)-4,6-dimethyl-1H-pyrimidine-2-thione |
| SMILES | Cc1nc(=S)[nH]c(C)c1NCCCN |
| InChI | InChI=1S/C9H16N4S/c1-6-8(11-5-3-4-10)7(2)13-9(14)12-6/h11H,3-5,10H2,1-2H3,(H,12,13,14) |
| InChIKey | ZCUCINDFDLCFBH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|