About 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione
3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione (PubChem CID 167268188) has the molecular formula C10H16N2S3
and a molecular weight of 260.45 g/mol. Its IUPAC name is 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione.
Molecular Properties
| Compound Name | 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione |
| PubChem CID | 167268188 |
| Molecular Formula | C10H16N2S3 |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione |
| SMILES | CSCc1c(NCCCCN)c(=S)c1=S |
| InChI | InChI=1S/C10H16N2S3/c1-15-6-7-8(10(14)9(7)13)12-5-3-2-4-11/h12H,2-6,11H2,1H3 |
| InChIKey | DEOMSNYNZTUEHD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione?
The IUPAC name of 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione (CID 167268188) is 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione.
What is the SMILES notation for 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione?
The canonical SMILES for 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione is CSCc1c(NCCCCN)c(=S)c1=S.
What is the InChIKey of 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione?
The InChIKey is DEOMSNYNZTUEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S3/c1-15-6-7-8(10(14)9(7)13)12-5-3-2-4-11/h12H,2-6,11H2,1H3.
What are the key properties of 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione?
3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione has a molecular weight of 260.45 g/mol, XLogP of 3.03, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminobutylamino)-4-(methylsulfanylmethyl)cyclobut-3-ene-1,2-dithione is sourced from PubChem (CID 167268188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).