C9H14N2OS2 — CID 146475260
3-[2-(2-aminoethoxy)ethylamino]-4-methylcyclobut-3-ene-1,2-dithione (PubChem CID 146475260) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethylamino]-4-methylcyclobut-3-ene-1,2-dithione.
| Compound Name | 3-[2-(2-aminoethoxy)ethylamino]-4-methylcyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 146475260 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethylamino]-4-methylcyclobut-3-ene-1,2-dithione |
| SMILES | Cc1c(NCCOCCN)c(=S)c1=S |
| InChI | InChI=1S/C9H14N2OS2/c1-6-7(9(14)8(6)13)11-3-5-12-4-2-10/h11H,2-5,10H2,1H3 |
| InChIKey | LJOFFVZOTRVPOU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|