C10H16N4S — CID 83839523
N'-(4-methyl-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)propane-1,3-diamine (PubChem CID 83839523) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is N'-(4-methyl-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)propane-1,3-diamine.
| Compound Name | N'-(4-methyl-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83839523 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N'-(4-methyl-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)propane-1,3-diamine |
| SMILES | Cc1nc(NCCCN)nc2c1CSC2 |
| InChI | InChI=1S/C10H16N4S/c1-7-8-5-15-6-9(8)14-10(13-7)12-4-2-3-11/h2-6,11H2,1H3,(H,12,13,14) |
| InChIKey | KIEMVGDNYRABMK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|