C11H15N3O3 — CID 83842467
4-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]butanoic acid (PubChem CID 83842467) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]butanoic acid.
| Compound Name | 4-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 83842467 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-[(4-methyl-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)amino]butanoic acid |
| SMILES | Cc1nc(NCCCC(=O)O)nc2c1COC2 |
| InChI | InChI=1S/C11H15N3O3/c1-7-8-5-17-6-9(8)14-11(13-7)12-4-2-3-10(15)16/h2-6H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | YSMVSNVYPHBZGL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|