C11H18ClN5O2 — CID 100915718
4-[[4-(tert-butylamino)-6-chloro-1,3,5-triazin-2-yl]amino]butanoic acid (PubChem CID 100915718) has the molecular formula C11H18ClN5O2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 4-[[4-(tert-butylamino)-6-chloro-1,3,5-triazin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[4-(tert-butylamino)-6-chloro-1,3,5-triazin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 100915718 |
| Molecular Formula | C11H18ClN5O2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-[[4-(tert-butylamino)-6-chloro-1,3,5-triazin-2-yl]amino]butanoic acid |
| SMILES | CC(C)(C)Nc1nc(Cl)nc(NCCCC(=O)O)n1 |
| InChI | InChI=1S/C11H18ClN5O2/c1-11(2,3)17-10-15-8(12)14-9(16-10)13-6-4-5-7(18)19/h4-6H2,1-3H3,(H,18,19)(H2,13,14,15,16,17) |
| InChIKey | CTMLHVPDXXZNPD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|