C11H22N2 — CID 170732072
(E)-N'-ethyl-N,N,3,4-tetramethylpent-2-enimidamide (PubChem CID 170732072) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (E)-N'-ethyl-N,N,3,4-tetramethylpent-2-enimidamide.
| Compound Name | (E)-N'-ethyl-N,N,3,4-tetramethylpent-2-enimidamide |
|---|---|
| PubChem CID | 170732072 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (E)-N'-ethyl-N,N,3,4-tetramethylpent-2-enimidamide |
| SMILES | CC/N=C(/C=C(\C)C(C)C)N(C)C |
| InChI | InChI=1S/C11H22N2/c1-7-12-11(13(5)6)8-10(4)9(2)3/h8-9H,7H2,1-6H3/b10-8+,12-11- |
| InChIKey | AMDZMTDUVOEDIP-GHGFDZLXSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|