C8H18N2O — CID 129086729
N'-ethyl-2-hydroxy-N,N-dimethylbutanimidamide (PubChem CID 129086729) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is N'-ethyl-2-hydroxy-N,N-dimethylbutanimidamide.
| Compound Name | N'-ethyl-2-hydroxy-N,N-dimethylbutanimidamide |
|---|---|
| PubChem CID | 129086729 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N'-ethyl-2-hydroxy-N,N-dimethylbutanimidamide |
| SMILES | CC/N=C(/C(O)CC)N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-5-7(11)8(9-6-2)10(3)4/h7,11H,5-6H2,1-4H3/b9-8- |
| InChIKey | JLDDCTIVNLSRHY-HJWRWDBZSA-N |
| XLogP | 0.74 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|