About 9H-anthracen-9-ide;carbanide;yttrium
9H-anthracen-9-ide;carbanide;yttrium (PubChem CID 170732925) has the molecular formula C15H12Y-2
and a molecular weight of 281.17 g/mol. Its IUPAC name is 9H-anthracen-9-ide;carbanide;yttrium.
Molecular Properties
| Compound Name | 9H-anthracen-9-ide;carbanide;yttrium |
| PubChem CID | 170732925 |
| Molecular Formula | C15H12Y-2 |
| Molecular Weight | 281.17 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 9H-anthracen-9-ide;carbanide;yttrium |
| SMILES | [CH3-].[Y].[c-]1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C14H9.CH3.Y/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;;/h1-9H;1H3;/q2*-1; |
| InChIKey | ILAHWDOPMNQJTP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-anthracen-9-ide;carbanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-anthracen-9-ide;carbanide;yttrium?
The IUPAC name of 9H-anthracen-9-ide;carbanide;yttrium (CID 170732925) is 9H-anthracen-9-ide;carbanide;yttrium.
What is the SMILES notation for 9H-anthracen-9-ide;carbanide;yttrium?
The canonical SMILES for 9H-anthracen-9-ide;carbanide;yttrium is [CH3-].[Y].[c-]1c2ccccc2cc2ccccc12.
What is the InChIKey of 9H-anthracen-9-ide;carbanide;yttrium?
The InChIKey is ILAHWDOPMNQJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9.CH3.Y/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;;/h1-9H;1H3;/q2*-1;.
What are the key properties of 9H-anthracen-9-ide;carbanide;yttrium?
9H-anthracen-9-ide;carbanide;yttrium has a molecular weight of 281.17 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-anthracen-9-ide;carbanide;yttrium is sourced from PubChem (CID 170732925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).