C17H20BrN3OS — CID 170737210
1-[[5-(3-bromophenyl)spiro[2.3]hexane-5-carbonyl]amino]-3-cyclopropylthiourea (PubChem CID 170737210) has the molecular formula C17H20BrN3OS and a molecular weight of 394.34 g/mol. Its IUPAC name is 1-[[5-(3-bromophenyl)spiro[2.3]hexane-5-carbonyl]amino]-3-cyclopropylthiourea.
| Compound Name | 1-[[5-(3-bromophenyl)spiro[2.3]hexane-5-carbonyl]amino]-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 170737210 |
| Molecular Formula | C17H20BrN3OS |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-[[5-(3-bromophenyl)spiro[2.3]hexane-5-carbonyl]amino]-3-cyclopropylthiourea |
| SMILES | O=C(NNC(=S)NC1CC1)C1(c2cccc(Br)c2)CC2(CC2)C1 |
| InChI | InChI=1S/C17H20BrN3OS/c18-12-3-1-2-11(8-12)17(9-16(10-17)6-7-16)14(22)20-21-15(23)19-13-4-5-13/h1-3,8,13H,4-7,9-10H2,(H,20,22)(H2,19,21,23) |
| InChIKey | KYYKTYMRDYOSLD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|