C6H11O2P — CID 170747106
6-methyl-5,7-dioxa-6-phosphaspiro[2.5]octane (PubChem CID 170747106) has the molecular formula C6H11O2P and a molecular weight of 146.13 g/mol. Its IUPAC name is 6-methyl-5,7-dioxa-6-phosphaspiro[2.5]octane.
| Compound Name | 6-methyl-5,7-dioxa-6-phosphaspiro[2.5]octane |
|---|---|
| PubChem CID | 170747106 |
| Molecular Formula | C6H11O2P |
| Molecular Weight | 146.13 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 6-methyl-5,7-dioxa-6-phosphaspiro[2.5]octane |
| SMILES | CP1OCC2(CC2)CO1 |
| InChI | InChI=1S/C6H11O2P/c1-9-7-4-6(2-3-6)5-8-9/h2-5H2,1H3 |
| InChIKey | HAVYAFBOLVNWGV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.13 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|