C8H18O4P2 — CID 158576549
3,9-dimethyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;methane (PubChem CID 158576549) has the molecular formula C8H18O4P2 and a molecular weight of 240.18 g/mol. Its IUPAC name is 3,9-dimethyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;methane.
| Compound Name | 3,9-dimethyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;methane |
|---|---|
| PubChem CID | 158576549 |
| Molecular Formula | C8H18O4P2 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3,9-dimethyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane;methane |
| SMILES | C.CP1OCC2(CO1)COP(C)OC2 |
| InChI | InChI=1S/C7H14O4P2.CH4/c1-12-8-3-7(4-9-12)5-10-13(2)11-6-7;/h3-6H2,1-2H3;1H4 |
| InChIKey | HSSPUPCWCDCKSQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|