C11H18N2 — CID 170747588
ethane;N-methyl-2,3-dihydro-1H-isoindol-4-amine (PubChem CID 170747588) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;N-methyl-2,3-dihydro-1H-isoindol-4-amine.
| Compound Name | ethane;N-methyl-2,3-dihydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 170747588 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;N-methyl-2,3-dihydro-1H-isoindol-4-amine |
| SMILES | CC.CNc1cccc2c1CNC2 |
| InChI | InChI=1S/C9H12N2.C2H6/c1-10-9-4-2-3-7-5-11-6-8(7)9;1-2/h2-4,10-11H,5-6H2,1H3;1-2H3 |
| InChIKey | HHOKHANEAQTTRV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |