C23H29N3O2 — CID 170748322
1-tert-butyl-3-[2-oxo-1-(1-phenylpropyl)-3,4-dihydroquinolin-6-yl]urea (PubChem CID 170748322) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-oxo-1-(1-phenylpropyl)-3,4-dihydroquinolin-6-yl]urea.
| Compound Name | 1-tert-butyl-3-[2-oxo-1-(1-phenylpropyl)-3,4-dihydroquinolin-6-yl]urea |
|---|---|
| PubChem CID | 170748322 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-tert-butyl-3-[2-oxo-1-(1-phenylpropyl)-3,4-dihydroquinolin-6-yl]urea |
| SMILES | CCC(c1ccccc1)N1C(=O)CCc2cc(NC(=O)NC(C)(C)C)ccc21 |
| InChI | InChI=1S/C23H29N3O2/c1-5-19(16-9-7-6-8-10-16)26-20-13-12-18(15-17(20)11-14-21(26)27)24-22(28)25-23(2,3)4/h6-10,12-13,15,19H,5,11,14H2,1-4H3,(H2,24,25,28) |
| InChIKey | KFLLTEXJAZNXNH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |