C20H24N4O2 — CID 170748426
1-(1-benzyl-2-oxo-3,4-dihydroquinazolin-6-yl)-3-tert-butylurea (PubChem CID 170748426) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(1-benzyl-2-oxo-3,4-dihydroquinazolin-6-yl)-3-tert-butylurea.
| Compound Name | 1-(1-benzyl-2-oxo-3,4-dihydroquinazolin-6-yl)-3-tert-butylurea |
|---|---|
| PubChem CID | 170748426 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-(1-benzyl-2-oxo-3,4-dihydroquinazolin-6-yl)-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)Nc1ccc2c(c1)CNC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H24N4O2/c1-20(2,3)23-18(25)22-16-9-10-17-15(11-16)12-21-19(26)24(17)13-14-7-5-4-6-8-14/h4-11H,12-13H2,1-3H3,(H,21,26)(H2,22,23,25) |
| InChIKey | LYASNTMBZMBUOH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |