C17H11Br2Cl2F3N2O2 — CID 170750986
2-chloro-N-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-(2,2-difluoroethylamino)phenyl]acetamide (PubChem CID 170750986) has the molecular formula C17H11Br2Cl2F3N2O2 and a molecular weight of 563.00 g/mol. Its IUPAC name is 2-chloro-N-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-(2,2-difluoroethylamino)phenyl]acetamide.
| Compound Name | 2-chloro-N-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-(2,2-difluoroethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 170750986 |
| Molecular Formula | C17H11Br2Cl2F3N2O2 |
| Molecular Weight | 563.00 g/mol |
| Exact Mass | 559.85 |
| IUPAC Name | 2-chloro-N-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-(2,2-difluoroethylamino)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1c(NCC(F)F)cc(Br)c(C(=O)c2cc(F)ccc2Cl)c1Br |
| InChI | InChI=1S/C17H11Br2Cl2F3N2O2/c18-9-4-11(25-6-12(23)24)16(26-13(27)5-20)15(19)14(9)17(28)8-3-7(22)1-2-10(8)21/h1-4,12,25H,5-6H2,(H,26,27) |
| InChIKey | MLVLIYJUQXYMTR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.00 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|