C17H14Br2ClF2N3O — CID 177201508
N'-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-[2-fluoroethyl(methyl)amino]phenyl]methanimidamide (PubChem CID 177201508) has the molecular formula C17H14Br2ClF2N3O and a molecular weight of 509.58 g/mol. Its IUPAC name is N'-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-[2-fluoroethyl(methyl)amino]phenyl]methanimidamide.
| Compound Name | N'-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-[2-fluoroethyl(methyl)amino]phenyl]methanimidamide |
|---|---|
| PubChem CID | 177201508 |
| Molecular Formula | C17H14Br2ClF2N3O |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 506.92 |
| IUPAC Name | N'-[2,4-dibromo-3-(2-chloro-5-fluorobenzoyl)-6-[2-fluoroethyl(methyl)amino]phenyl]methanimidamide |
| SMILES | CN(CCF)c1cc(Br)c(C(=O)c2cc(F)ccc2Cl)c(Br)c1/N=C/N |
| InChI | InChI=1S/C17H14Br2ClF2N3O/c1-25(5-4-21)13-7-11(18)14(15(19)16(13)24-8-23)17(26)10-6-9(22)2-3-12(10)20/h2-3,6-8H,4-5H2,1H3,(H2,23,24) |
| InChIKey | NFZCIUVNEWIRIV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|