C16H21ClN4O2 — CID 170753730
8-(1-aminoethyl)-6-chloro-3-ethyl-2-morpholin-4-ylquinazolin-4-one (PubChem CID 170753730) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 8-(1-aminoethyl)-6-chloro-3-ethyl-2-morpholin-4-ylquinazolin-4-one.
| Compound Name | 8-(1-aminoethyl)-6-chloro-3-ethyl-2-morpholin-4-ylquinazolin-4-one |
|---|---|
| PubChem CID | 170753730 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 8-(1-aminoethyl)-6-chloro-3-ethyl-2-morpholin-4-ylquinazolin-4-one |
| SMILES | CCn1c(N2CCOCC2)nc2c(C(C)N)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C16H21ClN4O2/c1-3-21-15(22)13-9-11(17)8-12(10(2)18)14(13)19-16(21)20-4-6-23-7-5-20/h8-10H,3-7,18H2,1-2H3 |
| InChIKey | BSCGELZBXJNNOY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |