C19H32N2O2S — CID 170754495
tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene (PubChem CID 170754495) has the molecular formula C19H32N2O2S and a molecular weight of 352.54 g/mol. Its IUPAC name is tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene.
| Compound Name | tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene |
|---|---|
| PubChem CID | 170754495 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene |
| SMILES | CC.CSC(CC#N)NC(=O)OC(C)(C)C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H16N2O2S.C8H10.C2H6/c1-9(2,3)13-8(12)11-7(14-4)5-6-10;1-7-3-5-8(2)6-4-7;1-2/h7H,5H2,1-4H3,(H,11,12);3-6H,1-2H3;1-2H3 |
| InChIKey | WHPFSBJNVRWNLD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|