About tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene
tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene (PubChem CID 170754495) has the molecular formula C19H32N2O2S
and a molecular weight of 352.54 g/mol. Its IUPAC name is tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene.
Molecular Properties
| Compound Name | tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene |
| PubChem CID | 170754495 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene |
| SMILES | CC.CSC(CC#N)NC(=O)OC(C)(C)C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H16N2O2S.C8H10.C2H6/c1-9(2,3)13-8(12)11-7(14-4)5-6-10;1-7-3-5-8(2)6-4-7;1-2/h7H,5H2,1-4H3,(H,11,12);3-6H,1-2H3;1-2H3 |
| InChIKey | WHPFSBJNVRWNLD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene?
The IUPAC name of tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene (CID 170754495) is tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene.
What is the SMILES notation for tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene?
The canonical SMILES for tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene is CC.CSC(CC#N)NC(=O)OC(C)(C)C.Cc1ccc(C)cc1.
What is the InChIKey of tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene?
The InChIKey is WHPFSBJNVRWNLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S.C8H10.C2H6/c1-9(2,3)13-8(12)11-7(14-4)5-6-10;1-7-3-5-8(2)6-4-7;1-2/h7H,5H2,1-4H3,(H,11,12);3-6H,1-2H3;1-2H3.
What are the key properties of tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene?
tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene has a molecular weight of 352.54 g/mol, XLogP of 5.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-cyano-1-methylsulfanylethyl)carbamate;ethane;1,4-xylene is sourced from PubChem (CID 170754495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).