C20H24N6O2 — CID 10762326
tert-butyl N-[1-[1-(2-cyanoethyl)tetrazol-5-yl]-4-(4-methylphenyl)but-3-ynyl]carbamate (PubChem CID 10762326) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(2-cyanoethyl)tetrazol-5-yl]-4-(4-methylphenyl)but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(2-cyanoethyl)tetrazol-5-yl]-4-(4-methylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 10762326 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | tert-butyl N-[1-[1-(2-cyanoethyl)tetrazol-5-yl]-4-(4-methylphenyl)but-3-ynyl]carbamate |
| SMILES | Cc1ccc(C#CCC(NC(=O)OC(C)(C)C)c2nnnn2CCC#N)cc1 |
| InChI | InChI=1S/C20H24N6O2/c1-15-9-11-16(12-10-15)7-5-8-17(22-19(27)28-20(2,3)4)18-23-24-25-26(18)14-6-13-21/h9-12,17H,6,8,14H2,1-4H3,(H,22,27) |
| InChIKey | ZHYWSLKHPIPWPS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|