C13H23N5O4 — CID 23404388
methyl 3-[5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]tetrazol-1-yl]propanoate (PubChem CID 23404388) has the molecular formula C13H23N5O4 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 3-[5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]tetrazol-1-yl]propanoate.
| Compound Name | methyl 3-[5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]tetrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 23404388 |
| Molecular Formula | C13H23N5O4 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | methyl 3-[5-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]tetrazol-1-yl]propanoate |
| SMILES | CCC(NC(=O)OC(C)(C)C)c1nnnn1CCC(=O)OC |
| InChI | InChI=1S/C13H23N5O4/c1-6-9(14-12(20)22-13(2,3)4)11-15-16-17-18(11)8-7-10(19)21-5/h9H,6-8H2,1-5H3,(H,14,20) |
| InChIKey | WNLYNLJDRLMHAF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |