C26H29N5O2 — CID 54448135
tert-butyl N-[(1R)-2-naphthalen-2-yl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethyl]carbamate (PubChem CID 54448135) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-naphthalen-2-yl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-naphthalen-2-yl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 54448135 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | tert-butyl N-[(1R)-2-naphthalen-2-yl-1-[1-(2-phenylethyl)tetrazol-5-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc2ccccc2c1)c1nnnn1CCc1ccccc1 |
| InChI | InChI=1S/C26H29N5O2/c1-26(2,3)33-25(32)27-23(18-20-13-14-21-11-7-8-12-22(21)17-20)24-28-29-30-31(24)16-15-19-9-5-4-6-10-19/h4-14,17,23H,15-16,18H2,1-3H3,(H,27,32)/t23-/m1/s1 |
| InChIKey | WTADUKWXJABEOI-HSZRJFAPSA-N |
| XLogP | 4.88 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |