C23H24N6O3 — CID 10788857
tert-butyl N-[(1S)-1-[1-(2-cyanoethyl)tetrazol-5-yl]-2-dibenzofuran-3-ylethyl]carbamate (PubChem CID 10788857) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[1-(2-cyanoethyl)tetrazol-5-yl]-2-dibenzofuran-3-ylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[1-(2-cyanoethyl)tetrazol-5-yl]-2-dibenzofuran-3-ylethyl]carbamate |
|---|---|
| PubChem CID | 10788857 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | tert-butyl N-[(1S)-1-[1-(2-cyanoethyl)tetrazol-5-yl]-2-dibenzofuran-3-ylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc2c(c1)oc1ccccc12)c1nnnn1CCC#N |
| InChI | InChI=1S/C23H24N6O3/c1-23(2,3)32-22(30)25-18(21-26-27-28-29(21)12-6-11-24)13-15-9-10-17-16-7-4-5-8-19(16)31-20(17)14-15/h4-5,7-10,14,18H,6,12-13H2,1-3H3,(H,25,30)/t18-/m0/s1 |
| InChIKey | VNKUBNDGZQSHCJ-SFHVURJKSA-N |
| XLogP | 4.29 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |