C22H41N5O3S — CID 170755119
8-[3-[[4-(methylamino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]propyl-(8-oxooctyl)amino]octanal (PubChem CID 170755119) has the molecular formula C22H41N5O3S and a molecular weight of 455.67 g/mol. Its IUPAC name is 8-[3-[[4-(methylamino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]propyl-(8-oxooctyl)amino]octanal.
| Compound Name | 8-[3-[[4-(methylamino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]propyl-(8-oxooctyl)amino]octanal |
|---|---|
| PubChem CID | 170755119 |
| Molecular Formula | C22H41N5O3S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 8-[3-[[4-(methylamino)-1-oxo-1,2,5-thiadiazol-3-yl]amino]propyl-(8-oxooctyl)amino]octanal |
| SMILES | CNC1=NS(=O)N=C1NCCCN(CCCCCCCC=O)CCCCCCCC=O |
| InChI | InChI=1S/C22H41N5O3S/c1-23-21-22(26-31(30)25-21)24-15-14-18-27(16-10-6-2-4-8-12-19-28)17-11-7-3-5-9-13-20-29/h19-20H,2-18H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | MFNGPWYNJTZVFP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|